About 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid
3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid (PubChem CID 122048117) has the molecular formula C15H14Cl2N2O4
and a molecular weight of 357.19 g/mol. Its IUPAC name is 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid |
| PubChem CID | 122048117 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid |
| SMILES | CCOC(=O)c1cnc2c(Cl)c(NCCC(=O)O)ccc2c1Cl |
| InChI | InChI=1S/C15H14Cl2N2O4/c1-2-23-15(22)9-7-19-14-8(12(9)16)3-4-10(13(14)17)18-6-5-11(20)21/h3-4,7,18H,2,5-6H2,1H3,(H,20,21) |
| InChIKey | WBSTUJJVXUZVEU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid?
The IUPAC name of 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid (CID 122048117) is 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid.
What is the SMILES notation for 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid?
The canonical SMILES for 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid is CCOC(=O)c1cnc2c(Cl)c(NCCC(=O)O)ccc2c1Cl.
What is the InChIKey of 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid?
The InChIKey is WBSTUJJVXUZVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N2O4/c1-2-23-15(22)9-7-19-14-8(12(9)16)3-4-10(13(14)17)18-6-5-11(20)21/h3-4,7,18H,2,5-6H2,1H3,(H,20,21).
What are the key properties of 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid?
3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid has a molecular weight of 357.19 g/mol, XLogP of 3.60, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,8-dichloro-3-ethoxycarbonylquinolin-7-yl)amino]propanoic acid is sourced from PubChem (CID 122048117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).