C12H16N6O2 — CID 122049696
(2S)-2-[(2-amino-6-pyrazol-1-ylpyrimidin-4-yl)amino]-3-methylbutanoic acid (PubChem CID 122049696) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is (2S)-2-[(2-amino-6-pyrazol-1-ylpyrimidin-4-yl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2-amino-6-pyrazol-1-ylpyrimidin-4-yl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122049696 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2S)-2-[(2-amino-6-pyrazol-1-ylpyrimidin-4-yl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](Nc1cc(-n2cccn2)nc(N)n1)C(=O)O |
| InChI | InChI=1S/C12H16N6O2/c1-7(2)10(11(19)20)15-8-6-9(17-12(13)16-8)18-5-3-4-14-18/h3-7,10H,1-2H3,(H,19,20)(H3,13,15,16,17)/t10-/m0/s1 |
| InChIKey | DIOJXGGOMYOASL-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |