About (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid
(2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid (PubChem CID 122051740) has the molecular formula C13H11Cl2N3O2
and a molecular weight of 312.16 g/mol. Its IUPAC name is (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 122051740 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1c1cnc2cc(Cl)c(Cl)cc2n1 |
| InChI | InChI=1S/C13H11Cl2N3O2/c14-7-4-9-10(5-8(7)15)17-12(6-16-9)18-3-1-2-11(18)13(19)20/h4-6,11H,1-3H2,(H,19,20)/t11-/m1/s1 |
| InChIKey | WQMVRDTXRJJSTI-LLVKDONJSA-N |
| XLogP | 2.99 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid (CID 122051740) is (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid is O=C(O)[C@H]1CCCN1c1cnc2cc(Cl)c(Cl)cc2n1.
What is the InChIKey of (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is WQMVRDTXRJJSTI-LLVKDONJSA-N. The full InChI is InChI=1S/C13H11Cl2N3O2/c14-7-4-9-10(5-8(7)15)17-12(6-16-9)18-3-1-2-11(18)13(19)20/h4-6,11H,1-3H2,(H,19,20)/t11-/m1/s1.
What are the key properties of (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid?
(2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 312.16 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(6,7-dichloroquinoxalin-2-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 122051740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).