C11H15N3O2S — CID 122051928
5-(6-methyl-1,4-thiazepan-4-yl)pyrazine-2-carboxylic acid (PubChem CID 122051928) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 5-(6-methyl-1,4-thiazepan-4-yl)pyrazine-2-carboxylic acid.
| Compound Name | 5-(6-methyl-1,4-thiazepan-4-yl)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122051928 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-(6-methyl-1,4-thiazepan-4-yl)pyrazine-2-carboxylic acid |
| SMILES | CC1CSCCN(c2cnc(C(=O)O)cn2)C1 |
| InChI | InChI=1S/C11H15N3O2S/c1-8-6-14(2-3-17-7-8)10-5-12-9(4-13-10)11(15)16/h4-5,8H,2-3,6-7H2,1H3,(H,15,16) |
| InChIKey | MWGNGJYBGXZTPN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |