C12H13N3O2 — CID 122052121
2-[methyl-(5-methylquinazolin-4-yl)amino]acetic acid (PubChem CID 122052121) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[methyl-(5-methylquinazolin-4-yl)amino]acetic acid.
| Compound Name | 2-[methyl-(5-methylquinazolin-4-yl)amino]acetic acid |
|---|---|
| PubChem CID | 122052121 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-[methyl-(5-methylquinazolin-4-yl)amino]acetic acid |
| SMILES | Cc1cccc2ncnc(N(C)CC(=O)O)c12 |
| InChI | InChI=1S/C12H13N3O2/c1-8-4-3-5-9-11(8)12(14-7-13-9)15(2)6-10(16)17/h3-5,7H,6H2,1-2H3,(H,16,17) |
| InChIKey | WBCPMPMYXPWXKD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |