C16H17FN2O3 — CID 122052635
1-(7-fluoro-6-methoxyisoquinolin-1-yl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122052635) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(7-fluoro-6-methoxyisoquinolin-1-yl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(7-fluoro-6-methoxyisoquinolin-1-yl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122052635 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(7-fluoro-6-methoxyisoquinolin-1-yl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | COc1cc2ccnc(N3CCC(C)(C(=O)O)C3)c2cc1F |
| InChI | InChI=1S/C16H17FN2O3/c1-16(15(20)21)4-6-19(9-16)14-11-8-12(17)13(22-2)7-10(11)3-5-18-14/h3,5,7-8H,4,6,9H2,1-2H3,(H,20,21) |
| InChIKey | OXEJBIUFHTVPKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |