C15H17N5O3 — CID 122055053
5-[(6-morpholin-4-yl-2-pyridinyl)methylamino]pyrazine-2-carboxylic acid (PubChem CID 122055053) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-[(6-morpholin-4-yl-2-pyridinyl)methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(6-morpholin-4-yl-2-pyridinyl)methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122055053 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-[(6-morpholin-4-yl-2-pyridinyl)methylamino]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCc2cccc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C15H17N5O3/c21-15(22)12-9-18-13(10-16-12)17-8-11-2-1-3-14(19-11)20-4-6-23-7-5-20/h1-3,9-10H,4-8H2,(H,17,18)(H,21,22) |
| InChIKey | LHGCTQUPADSLLN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |