About 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid
5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid (PubChem CID 122055511) has the molecular formula C14H17N5O3
and a molecular weight of 303.32 g/mol. Its IUPAC name is 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid |
| PubChem CID | 122055511 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2Nc2cnc(C(=O)O)cn2)cn1 |
| InChI | InChI=1S/C14H17N5O3/c1-19-8-9(5-17-19)13-10(3-2-4-22-13)18-12-7-15-11(6-16-12)14(20)21/h5-8,10,13H,2-4H2,1H3,(H,16,18)(H,20,21)/t10-,13+/m0/s1 |
| InChIKey | ZUXDAYUHIUNMLK-GXFFZTMASA-N |
| XLogP | 1.24 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid?
The IUPAC name of 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid (CID 122055511) is 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid.
What is the SMILES notation for 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid?
The canonical SMILES for 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid is Cn1cc([C@H]2OCCC[C@@H]2Nc2cnc(C(=O)O)cn2)cn1.
What is the InChIKey of 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid?
The InChIKey is ZUXDAYUHIUNMLK-GXFFZTMASA-N. The full InChI is InChI=1S/C14H17N5O3/c1-19-8-9(5-17-19)13-10(3-2-4-22-13)18-12-7-15-11(6-16-12)14(20)21/h5-8,10,13H,2-4H2,1H3,(H,16,18)(H,20,21)/t10-,13+/m0/s1.
What are the key properties of 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid?
5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid has a molecular weight of 303.32 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]amino]pyrazine-2-carboxylic acid is sourced from PubChem (CID 122055511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).