2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid

C13H16N2O4 — CID 122055971

IUPAC2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid
SMILESCC1OCCN(C(=O)c2cc(C(=O)O)ccn2)C1C
InChIInChI=1S/C13H16N2O4/c1-8-9(2)19-6-5-15(8)12(16)11-7-10(13(17)18)3-4-14-11/h3-4,7-9H,5-6H2,1-2H3,(H,17,18)
InChIKeyVWJFNLSCHUECQH-UHFFFAOYSA-N
MW264.28 g/mol
LogP1.03
Rot. Bonds2

About 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid

2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid (PubChem CID 122055971) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid.

Molecular Properties

Compound Name2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid
PubChem CID122055971
Molecular FormulaC13H16N2O4
Molecular Weight264.28 g/mol
Exact Mass264.11
IUPAC Name2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid
SMILESCC1OCCN(C(=O)c2cc(C(=O)O)ccn2)C1C
InChIInChI=1S/C13H16N2O4/c1-8-9(2)19-6-5-15(8)12(16)11-7-10(13(17)18)3-4-14-11/h3-4,7-9H,5-6H2,1-2H3,(H,17,18)
InChIKeyVWJFNLSCHUECQH-UHFFFAOYSA-N
XLogP1.03
TPSA79.73 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid?
The IUPAC name of 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid (CID 122055971) is 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid.
What is the SMILES notation for 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid?
The canonical SMILES for 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid is CC1OCCN(C(=O)c2cc(C(=O)O)ccn2)C1C.
What is the InChIKey of 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid?
The InChIKey is VWJFNLSCHUECQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-8-9(2)19-6-5-15(8)12(16)11-7-10(13(17)18)3-4-14-11/h3-4,7-9H,5-6H2,1-2H3,(H,17,18).
What are the key properties of 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid?
2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid has a molecular weight of 264.28 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylmorpholine-4-carbonyl)pyridine-4-carboxylic acid is sourced from PubChem (CID 122055971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).