C13H17N3O3 — CID 122056083
6-(4-ethyl-3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid (PubChem CID 122056083) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-(4-ethyl-3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 6-(4-ethyl-3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122056083 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-(4-ethyl-3-oxo-1,4-diazepan-1-yl)pyridine-2-carboxylic acid |
| SMILES | CCN1CCCN(c2cccc(C(=O)O)n2)CC1=O |
| InChI | InChI=1S/C13H17N3O3/c1-2-15-7-4-8-16(9-12(15)17)11-6-3-5-10(14-11)13(18)19/h3,5-6H,2,4,7-9H2,1H3,(H,18,19) |
| InChIKey | MMXPWDLSFYIMGS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |