C11H12F4N2O3 — CID 122056802
6-[2-(2,2,3,3-tetrafluoropropoxy)ethylamino]pyridine-2-carboxylic acid (PubChem CID 122056802) has the molecular formula C11H12F4N2O3 and a molecular weight of 296.22 g/mol. Its IUPAC name is 6-[2-(2,2,3,3-tetrafluoropropoxy)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-(2,2,3,3-tetrafluoropropoxy)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122056802 |
| Molecular Formula | C11H12F4N2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-[2-(2,2,3,3-tetrafluoropropoxy)ethylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NCCOCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C11H12F4N2O3/c12-10(13)11(14,15)6-20-5-4-16-8-3-1-2-7(17-8)9(18)19/h1-3,10H,4-6H2,(H,16,17)(H,18,19) |
| InChIKey | KHEALGXADRZARR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|