C11H14FN3O3 — CID 122057196
6-[[1-(2-fluoroethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxylic acid (PubChem CID 122057196) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is 6-[[1-(2-fluoroethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[1-(2-fluoroethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122057196 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-[[1-(2-fluoroethylamino)-1-oxopropan-2-yl]amino]pyridine-2-carboxylic acid |
| SMILES | CC(Nc1cccc(C(=O)O)n1)C(=O)NCCF |
| InChI | InChI=1S/C11H14FN3O3/c1-7(10(16)13-6-5-12)14-9-4-2-3-8(15-9)11(17)18/h2-4,7H,5-6H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | IQDAROGVBSWPSO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |