C13H16F2N2O2 — CID 122058210
6-[[4-(difluoromethyl)cyclohexyl]amino]pyridine-2-carboxylic acid (PubChem CID 122058210) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 6-[[4-(difluoromethyl)cyclohexyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[[4-(difluoromethyl)cyclohexyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 122058210 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 6-[[4-(difluoromethyl)cyclohexyl]amino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NC2CCC(C(F)F)CC2)n1 |
| InChI | InChI=1S/C13H16F2N2O2/c14-12(15)8-4-6-9(7-5-8)16-11-3-1-2-10(17-11)13(18)19/h1-3,8-9,12H,4-7H2,(H,16,17)(H,18,19) |
| InChIKey | BPGNXDZMMINJLN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |