C16H18N4O2 — CID 122058595
4-[(2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]butanoic acid (PubChem CID 122058595) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-[(2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 4-[(2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 122058595 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-[(2-pyridin-2-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)CCCNc1nc(-c2ccccn2)nc2c1CCC2 |
| InChI | InChI=1S/C16H18N4O2/c21-14(22)8-4-10-18-15-11-5-3-7-12(11)19-16(20-15)13-6-1-2-9-17-13/h1-2,6,9H,3-5,7-8,10H2,(H,21,22)(H,18,19,20) |
| InChIKey | SLKBFEYPHPOLGR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|