C14H16N2O6 — CID 122058970
1-(3-ethoxycarbonyl-4-nitrophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 122058970) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-(3-ethoxycarbonyl-4-nitrophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(3-ethoxycarbonyl-4-nitrophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122058970 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(3-ethoxycarbonyl-4-nitrophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc(N2CCCC2C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O6/c1-2-22-14(19)10-8-9(5-6-11(10)16(20)21)15-7-3-4-12(15)13(17)18/h5-6,8,12H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | BZUWWHYORORYKB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|