About 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide
1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide (PubChem CID 1220591) has the molecular formula C8H7N5O3S
and a molecular weight of 253.24 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide |
| PubChem CID | 1220591 |
| Molecular Formula | C8H7N5O3S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H7N5O3S/c1-12-6(5(4-10-12)13(15)16)7(14)11-8-9-2-3-17-8/h2-4H,1H3,(H,9,11,14) |
| InChIKey | ANMCEFNNAFUIBR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The IUPAC name of 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide (CID 1220591) is 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide.
What is the SMILES notation for 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The canonical SMILES for 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide is Cn1ncc([N+](=O)[O-])c1C(=O)Nc1nccs1.
What is the InChIKey of 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
The InChIKey is ANMCEFNNAFUIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O3S/c1-12-6(5(4-10-12)13(15)16)7(14)11-8-9-2-3-17-8/h2-4H,1H3,(H,9,11,14).
What are the key properties of 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide?
1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide has a molecular weight of 253.24 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-nitro-N-(1,3-thiazol-2-yl)pyrazole-5-carboxamide is sourced from PubChem (CID 1220591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).