About 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid
4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122060103) has the molecular formula C15H15F2N3O2
and a molecular weight of 307.30 g/mol. Its IUPAC name is 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 122060103 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cnc3cc(F)c(F)cc3n2)CC1 |
| InChI | InChI=1S/C15H15F2N3O2/c16-10-5-12-13(6-11(10)17)20-14(7-18-12)19-9-3-1-8(2-4-9)15(21)22/h5-9H,1-4H2,(H,19,20)(H,21,22) |
| InChIKey | GIVGVQDNVGKNIK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid (CID 122060103) is 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid is O=C(O)C1CCC(Nc2cnc3cc(F)c(F)cc3n2)CC1.
What is the InChIKey of 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid?
The InChIKey is GIVGVQDNVGKNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N3O2/c16-10-5-12-13(6-11(10)17)20-14(7-18-12)19-9-3-1-8(2-4-9)15(21)22/h5-9H,1-4H2,(H,19,20)(H,21,22).
What are the key properties of 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid?
4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid has a molecular weight of 307.30 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6,7-difluoroquinoxalin-2-yl)amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 122060103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).