2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid

C14H17N3O3 — CID 122060308

IUPAC2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid
SMILESCCCCC(Nc1cc(=O)n2ccccc2n1)C(=O)O
InChIInChI=1S/C14H17N3O3/c1-2-3-6-10(14(19)20)15-11-9-13(18)17-8-5-4-7-12(17)16-11/h4-5,7-10,15H,2-3,6H2,1H3,(H,19,20)
InChIKeyCKOVBCOYECTATN-UHFFFAOYSA-N
MW275.31 g/mol
LogP1.75
Rot. Bonds6

About 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid

2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid (PubChem CID 122060308) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid.

Molecular Properties

Compound Name2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid
PubChem CID122060308
Molecular FormulaC14H17N3O3
Molecular Weight275.31 g/mol
Exact Mass275.13
IUPAC Name2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid
SMILESCCCCC(Nc1cc(=O)n2ccccc2n1)C(=O)O
InChIInChI=1S/C14H17N3O3/c1-2-3-6-10(14(19)20)15-11-9-13(18)17-8-5-4-7-12(17)16-11/h4-5,7-10,15H,2-3,6H2,1H3,(H,19,20)
InChIKeyCKOVBCOYECTATN-UHFFFAOYSA-N
XLogP1.75
TPSA83.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.31
LogP ≤ 51.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The IUPAC name of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid (CID 122060308) is 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid.
What is the SMILES notation for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The canonical SMILES for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid is CCCCC(Nc1cc(=O)n2ccccc2n1)C(=O)O.
What is the InChIKey of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The InChIKey is CKOVBCOYECTATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-2-3-6-10(14(19)20)15-11-9-13(18)17-8-5-4-7-12(17)16-11/h4-5,7-10,15H,2-3,6H2,1H3,(H,19,20).
What are the key properties of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid has a molecular weight of 275.31 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid is sourced from PubChem (CID 122060308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).