About 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid
2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid (PubChem CID 122060308) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid.
Molecular Properties
| Compound Name | 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid |
| PubChem CID | 122060308 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid |
| SMILES | CCCCC(Nc1cc(=O)n2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-2-3-6-10(14(19)20)15-11-9-13(18)17-8-5-4-7-12(17)16-11/h4-5,7-10,15H,2-3,6H2,1H3,(H,19,20) |
| InChIKey | CKOVBCOYECTATN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The IUPAC name of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid (CID 122060308) is 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid.
What is the SMILES notation for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The canonical SMILES for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid is CCCCC(Nc1cc(=O)n2ccccc2n1)C(=O)O.
What is the InChIKey of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
The InChIKey is CKOVBCOYECTATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-2-3-6-10(14(19)20)15-11-9-13(18)17-8-5-4-7-12(17)16-11/h4-5,7-10,15H,2-3,6H2,1H3,(H,19,20).
What are the key properties of 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid?
2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid has a molecular weight of 275.31 g/mol, XLogP of 1.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]hexanoic acid is sourced from PubChem (CID 122060308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).