C15H17N3O3 — CID 122060540
2-[(4-phenoxypyrimidin-2-yl)amino]pentanoic acid (PubChem CID 122060540) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-[(4-phenoxypyrimidin-2-yl)amino]pentanoic acid.
| Compound Name | 2-[(4-phenoxypyrimidin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122060540 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[(4-phenoxypyrimidin-2-yl)amino]pentanoic acid |
| SMILES | CCCC(Nc1nccc(Oc2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C15H17N3O3/c1-2-6-12(14(19)20)17-15-16-10-9-13(18-15)21-11-7-4-3-5-8-11/h3-5,7-10,12H,2,6H2,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | GQNZVQAPAUYQIB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |