C13H13F2N3O2 — CID 122060632
2-[(6,7-difluoroquinoxalin-2-yl)amino]pentanoic acid (PubChem CID 122060632) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-[(6,7-difluoroquinoxalin-2-yl)amino]pentanoic acid.
| Compound Name | 2-[(6,7-difluoroquinoxalin-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 122060632 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[(6,7-difluoroquinoxalin-2-yl)amino]pentanoic acid |
| SMILES | CCCC(Nc1cnc2cc(F)c(F)cc2n1)C(=O)O |
| InChI | InChI=1S/C13H13F2N3O2/c1-2-3-9(13(19)20)17-12-6-16-10-4-7(14)8(15)5-11(10)18-12/h4-6,9H,2-3H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | UBNNRKGOHLCKHU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |