C18H22N4O2 — CID 122061367
2-[cyclopropylmethyl-[3-(quinoxalin-2-ylamino)cyclobutyl]amino]acetic acid (PubChem CID 122061367) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-(quinoxalin-2-ylamino)cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-(quinoxalin-2-ylamino)cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122061367 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-(quinoxalin-2-ylamino)cyclobutyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(Nc2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C18H22N4O2/c23-18(24)11-22(10-12-5-6-12)14-7-13(8-14)20-17-9-19-15-3-1-2-4-16(15)21-17/h1-4,9,12-14H,5-8,10-11H2,(H,20,21)(H,23,24) |
| InChIKey | WEBPFXSCBZRGID-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |