About 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid
2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122061823) has the molecular formula C17H25N5O2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid |
| PubChem CID | 122061823 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCc1nnc(NC2CC(N(CC)CC(=O)O)C2)c(C#N)c1CC |
| InChI | InChI=1S/C17H25N5O2/c1-4-13-14(9-18)17(21-20-15(13)5-2)19-11-7-12(8-11)22(6-3)10-16(23)24/h11-12H,4-8,10H2,1-3H3,(H,19,21)(H,23,24) |
| InChIKey | YDJORJYAQCEFLP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid?
The IUPAC name of 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid (CID 122061823) is 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid.
What is the SMILES notation for 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid?
The canonical SMILES for 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid is CCc1nnc(NC2CC(N(CC)CC(=O)O)C2)c(C#N)c1CC.
What is the InChIKey of 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid?
The InChIKey is YDJORJYAQCEFLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O2/c1-4-13-14(9-18)17(21-20-15(13)5-2)19-11-7-12(8-11)22(6-3)10-16(23)24/h11-12H,4-8,10H2,1-3H3,(H,19,21)(H,23,24).
What are the key properties of 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid?
2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid has a molecular weight of 331.42 g/mol, XLogP of 1.82, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[(4-cyano-5,6-diethylpyridazin-3-yl)amino]cyclobutyl]-ethylamino]acetic acid is sourced from PubChem (CID 122061823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).