About 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid
2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid (PubChem CID 122062259) has the molecular formula C18H23N3O2S
and a molecular weight of 345.47 g/mol. Its IUPAC name is 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid |
| PubChem CID | 122062259 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(c2ncc(-c3ccccc3)s2)CC1 |
| InChI | InChI=1S/C18H23N3O2S/c1-2-20(13-17(22)23)15-8-10-21(11-9-15)18-19-12-16(24-18)14-6-4-3-5-7-14/h3-7,12,15H,2,8-11,13H2,1H3,(H,22,23) |
| InChIKey | JBWGELJGAFNUJQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid?
The IUPAC name of 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid (CID 122062259) is 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid.
What is the SMILES notation for 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid?
The canonical SMILES for 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid is CCN(CC(=O)O)C1CCN(c2ncc(-c3ccccc3)s2)CC1.
What is the InChIKey of 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid?
The InChIKey is JBWGELJGAFNUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2S/c1-2-20(13-17(22)23)15-8-10-21(11-9-15)18-19-12-16(24-18)14-6-4-3-5-7-14/h3-7,12,15H,2,8-11,13H2,1H3,(H,22,23).
What are the key properties of 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid?
2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid has a molecular weight of 345.47 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-[1-(5-phenyl-1,3-thiazol-2-yl)piperidin-4-yl]amino]acetic acid is sourced from PubChem (CID 122062259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).