About 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid
2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid (PubChem CID 122062316) has the molecular formula C19H23F2N3O2
and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid |
| PubChem CID | 122062316 |
| Molecular Formula | C19H23F2N3O2 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(c2cc(C)nc3c(F)c(F)ccc23)CC1 |
| InChI | InChI=1S/C19H23F2N3O2/c1-3-23(11-17(25)26)13-6-8-24(9-7-13)16-10-12(2)22-19-14(16)4-5-15(20)18(19)21/h4-5,10,13H,3,6-9,11H2,1-2H3,(H,25,26) |
| InChIKey | YLLAAMHEUMZIIE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid?
The IUPAC name of 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid (CID 122062316) is 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid.
What is the SMILES notation for 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid?
The canonical SMILES for 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid is CCN(CC(=O)O)C1CCN(c2cc(C)nc3c(F)c(F)ccc23)CC1.
What is the InChIKey of 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid?
The InChIKey is YLLAAMHEUMZIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23F2N3O2/c1-3-23(11-17(25)26)13-6-8-24(9-7-13)16-10-12(2)22-19-14(16)4-5-15(20)18(19)21/h4-5,10,13H,3,6-9,11H2,1-2H3,(H,25,26).
What are the key properties of 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid?
2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid has a molecular weight of 363.41 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(7,8-difluoro-2-methylquinolin-4-yl)piperidin-4-yl]-ethylamino]acetic acid is sourced from PubChem (CID 122062316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).