C12H19N3O4 — CID 122062796
(2S)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]hexanoic acid (PubChem CID 122062796) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 122062796 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2S)-2-[[6-(2-hydroxyethoxy)pyrazin-2-yl]amino]hexanoic acid |
| SMILES | CCCC[C@H](Nc1cncc(OCCO)n1)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-2-3-4-9(12(17)18)14-10-7-13-8-11(15-10)19-6-5-16/h7-9,16H,2-6H2,1H3,(H,14,15)(H,17,18)/t9-/m0/s1 |
| InChIKey | OVGMAOYPFHHNDM-VIFPVBQESA-N |
| XLogP | 0.90 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |