C14H20F3N5O2 — CID 122063665
(3S,4S)-1-[2-amino-6-(butylamino)pyrimidin-4-yl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122063665) has the molecular formula C14H20F3N5O2 and a molecular weight of 347.34 g/mol. Its IUPAC name is (3S,4S)-1-[2-amino-6-(butylamino)pyrimidin-4-yl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-amino-6-(butylamino)pyrimidin-4-yl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122063665 |
| Molecular Formula | C14H20F3N5O2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (3S,4S)-1-[2-amino-6-(butylamino)pyrimidin-4-yl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | CCCCNc1cc(N2C[C@@H](C(F)(F)F)[C@H](C(=O)O)C2)nc(N)n1 |
| InChI | InChI=1S/C14H20F3N5O2/c1-2-3-4-19-10-5-11(21-13(18)20-10)22-6-8(12(23)24)9(7-22)14(15,16)17/h5,8-9H,2-4,6-7H2,1H3,(H,23,24)(H3,18,19,20,21)/t8-,9-/m1/s1 |
| InChIKey | MMSWLZTVOJLZON-RKDXNWHRSA-N |
| XLogP | 1.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|