C13H16F3N3O3 — CID 122066237
2-methyl-3-oxo-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]propanoic acid (PubChem CID 122066237) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122066237 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-methyl-3-oxo-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCCC(c2ncc(C(F)(F)F)[nH]2)C1 |
| InChI | InChI=1S/C13H16F3N3O3/c1-7(12(21)22)11(20)19-4-2-3-8(6-19)10-17-5-9(18-10)13(14,15)16/h5,7-8H,2-4,6H2,1H3,(H,17,18)(H,21,22) |
| InChIKey | SUPJVRWKEFLGMX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|