C14H20N2O3S — CID 122066258
3-[(2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-methylamino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066258) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-[(2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-methylamino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[(2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-methylamino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066258 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[(2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl)-methylamino]-2-methyl-3-oxopropanoic acid |
| SMILES | CCc1nc2c(s1)C(N(C)C(=O)C(C)C(=O)O)CCC2 |
| InChI | InChI=1S/C14H20N2O3S/c1-4-11-15-9-6-5-7-10(12(9)20-11)16(3)13(17)8(2)14(18)19/h8,10H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | CRRBQKNJACIXTR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|