C15H17FN2O4 — CID 122066411
3-[[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid (PubChem CID 122066411) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 3-[[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122066411 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 3-[[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)NC1CCN(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C15H17FN2O4/c1-9(15(21)22)13(19)17-12-6-7-18(14(12)20)8-10-2-4-11(16)5-3-10/h2-5,9,12H,6-8H2,1H3,(H,17,19)(H,21,22) |
| InChIKey | LQWUOITWPXPQEP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|