C14H16F3NO4 — CID 122066448
2-methyl-3-oxo-3-[[3-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]propanoic acid (PubChem CID 122066448) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[[3-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[[3-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 122066448 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-methyl-3-oxo-3-[[3-(2,2,2-trifluoroethoxymethyl)phenyl]methylamino]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)NCc1cccc(COCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO4/c1-9(13(20)21)12(19)18-6-10-3-2-4-11(5-10)7-22-8-14(15,16)17/h2-5,9H,6-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | POVHGIUXBVFPTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|