C15H16F3NO4 — CID 122066523
2-methyl-3-oxo-3-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid (PubChem CID 122066523) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 122066523 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-methyl-3-oxo-3-[2-[4-(trifluoromethyl)phenyl]morpholin-4-yl]propanoic acid |
| SMILES | CC(C(=O)O)C(=O)N1CCOC(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H16F3NO4/c1-9(14(21)22)13(20)19-6-7-23-12(8-19)10-2-4-11(5-3-10)15(16,17)18/h2-5,9,12H,6-8H2,1H3,(H,21,22) |
| InChIKey | WAOWTLQOXPKBFU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|