C14H16INO3 — CID 122067423
2-[cyclopropyl-[2-(4-iodophenyl)acetyl]amino]propanoic acid (PubChem CID 122067423) has the molecular formula C14H16INO3 and a molecular weight of 373.19 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(4-iodophenyl)acetyl]amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-[2-(4-iodophenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122067423 |
| Molecular Formula | C14H16INO3 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-[cyclopropyl-[2-(4-iodophenyl)acetyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)Cc1ccc(I)cc1)C1CC1 |
| InChI | InChI=1S/C14H16INO3/c1-9(14(18)19)16(12-6-7-12)13(17)8-10-2-4-11(15)5-3-10/h2-5,9,12H,6-8H2,1H3,(H,18,19) |
| InChIKey | REYNGOJMZKICOL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|