About 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid
2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid (PubChem CID 122068273) has the molecular formula C6H7BrN2O4S2
and a molecular weight of 315.17 g/mol. Its IUPAC name is 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid |
| PubChem CID | 122068273 |
| Molecular Formula | C6H7BrN2O4S2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid |
| SMILES | Cc1nc(S(=O)(=O)NCC(=O)O)sc1Br |
| InChI | InChI=1S/C6H7BrN2O4S2/c1-3-5(7)14-6(9-3)15(12,13)8-2-4(10)11/h8H,2H2,1H3,(H,10,11) |
| InChIKey | GSDHPPQKOSBGKN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid?
The IUPAC name of 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid (CID 122068273) is 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid.
What is the SMILES notation for 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid?
The canonical SMILES for 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid is Cc1nc(S(=O)(=O)NCC(=O)O)sc1Br.
What is the InChIKey of 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid?
The InChIKey is GSDHPPQKOSBGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2O4S2/c1-3-5(7)14-6(9-3)15(12,13)8-2-4(10)11/h8H,2H2,1H3,(H,10,11).
What are the key properties of 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid?
2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid has a molecular weight of 315.17 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-bromo-4-methyl-1,3-thiazol-2-yl)sulfonylamino]acetic acid is sourced from PubChem (CID 122068273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).