C15H28N2O5S — CID 122068734
4-[2-(1-acetylpiperidin-2-yl)ethylsulfonylamino]-4-methylpentanoic acid (PubChem CID 122068734) has the molecular formula C15H28N2O5S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[2-(1-acetylpiperidin-2-yl)ethylsulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[2-(1-acetylpiperidin-2-yl)ethylsulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122068734 |
| Molecular Formula | C15H28N2O5S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4-[2-(1-acetylpiperidin-2-yl)ethylsulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(=O)N1CCCCC1CCS(=O)(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C15H28N2O5S/c1-12(18)17-10-5-4-6-13(17)8-11-23(21,22)16-15(2,3)9-7-14(19)20/h13,16H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | IXROUWBJLOHQMD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |