C14H20FNO4S — CID 122068883
4-[(3-fluoro-4-methylphenyl)methylsulfonylamino]-4-methylpentanoic acid (PubChem CID 122068883) has the molecular formula C14H20FNO4S and a molecular weight of 317.38 g/mol. Its IUPAC name is 4-[(3-fluoro-4-methylphenyl)methylsulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-fluoro-4-methylphenyl)methylsulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122068883 |
| Molecular Formula | C14H20FNO4S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-[(3-fluoro-4-methylphenyl)methylsulfonylamino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(CS(=O)(=O)NC(C)(C)CCC(=O)O)cc1F |
| InChI | InChI=1S/C14H20FNO4S/c1-10-4-5-11(8-12(10)15)9-21(19,20)16-14(2,3)7-6-13(17)18/h4-5,8,16H,6-7,9H2,1-3H3,(H,17,18) |
| InChIKey | BTDKFNWLQHLFBE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |