C16H20FN3O4S — CID 122070394
2-[ethyl-[3-[(4-fluoro-1H-indol-3-yl)sulfonylamino]cyclobutyl]amino]acetic acid (PubChem CID 122070394) has the molecular formula C16H20FN3O4S and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[ethyl-[3-[(4-fluoro-1H-indol-3-yl)sulfonylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(4-fluoro-1H-indol-3-yl)sulfonylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122070394 |
| Molecular Formula | C16H20FN3O4S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[ethyl-[3-[(4-fluoro-1H-indol-3-yl)sulfonylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NS(=O)(=O)c2c[nH]c3cccc(F)c23)C1 |
| InChI | InChI=1S/C16H20FN3O4S/c1-2-20(9-15(21)22)11-6-10(7-11)19-25(23,24)14-8-18-13-5-3-4-12(17)16(13)14/h3-5,8,10-11,18-19H,2,6-7,9H2,1H3,(H,21,22) |
| InChIKey | LDAVDLMZLQJSDS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |