C15H16ClN3O4S — CID 122070644
(3aS,6aR)-2-[(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122070644) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is (3aS,6aR)-2-[(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122070644 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (3aS,6aR)-2-[(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)sulfonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(S(=O)(=O)c1c[nH]c3nccc(Cl)c13)C2 |
| InChI | InChI=1S/C15H16ClN3O4S/c16-10-3-5-17-13-12(10)11(6-18-13)24(22,23)19-7-9-2-1-4-15(9,8-19)14(20)21/h3,5-6,9H,1-2,4,7-8H2,(H,17,18)(H,20,21)/t9-,15+/m0/s1 |
| InChIKey | OSUGPGQFUQMYHY-BJOHPYRUSA-N |
| XLogP | 2.09 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |