C16H21NO5S — CID 122070688
(3aS,6aR)-2-[4-(methoxymethyl)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122070688) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is (3aS,6aR)-2-[4-(methoxymethyl)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[4-(methoxymethyl)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122070688 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3aS,6aR)-2-[4-(methoxymethyl)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | COCc1ccc(S(=O)(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-22-10-12-4-6-14(7-5-12)23(20,21)17-9-13-3-2-8-16(13,11-17)15(18)19/h4-7,13H,2-3,8-11H2,1H3,(H,18,19)/t13-,16+/m0/s1 |
| InChIKey | IMUQUBNCGULFKJ-XJKSGUPXSA-N |
| XLogP | 1.71 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |