C16H19F2NO5S — CID 122070715
(3aS,6aR)-2-[4-(2,2-difluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122070715) has the molecular formula C16H19F2NO5S and a molecular weight of 375.39 g/mol. Its IUPAC name is (3aS,6aR)-2-[4-(2,2-difluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[4-(2,2-difluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122070715 |
| Molecular Formula | C16H19F2NO5S |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3aS,6aR)-2-[4-(2,2-difluoroethoxy)phenyl]sulfonyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(O)[C@@]12CCC[C@H]1CN(S(=O)(=O)c1ccc(OCC(F)F)cc1)C2 |
| InChI | InChI=1S/C16H19F2NO5S/c17-14(18)9-24-12-3-5-13(6-4-12)25(22,23)19-8-11-2-1-7-16(11,10-19)15(20)21/h3-6,11,14H,1-2,7-10H2,(H,20,21)/t11-,16+/m0/s1 |
| InChIKey | XUJIIPQYEFESCQ-MEDUHNTESA-N |
| XLogP | 2.21 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |