C19H29NO3 — CID 122073142
2-[[(3-cyclopentyloxyphenyl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122073142) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is 2-[[(3-cyclopentyloxyphenyl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(3-cyclopentyloxyphenyl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122073142 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 2-[[(3-cyclopentyloxyphenyl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1cccc(OC2CCCC2)c1)C(=O)O |
| InChI | InChI=1S/C19H29NO3/c1-14(2)10-16(19(21)22)13-20-12-15-6-5-9-18(11-15)23-17-7-3-4-8-17/h5-6,9,11,14,16-17,20H,3-4,7-8,10,12-13H2,1-2H3,(H,21,22) |
| InChIKey | OZHHWZYGQQYVTB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |