C15H20ClN3O5 — CID 122074139
3-[(5-chloro-2-morpholin-4-ylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122074139) has the molecular formula C15H20ClN3O5 and a molecular weight of 357.79 g/mol. Its IUPAC name is 3-[(5-chloro-2-morpholin-4-ylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122074139 |
| Molecular Formula | C15H20ClN3O5 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-[(5-chloro-2-morpholin-4-ylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)Nc1cc(Cl)ccc1N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C15H20ClN3O5/c1-15(23,13(20)21)9-17-14(22)18-11-8-10(16)2-3-12(11)19-4-6-24-7-5-19/h2-3,8,23H,4-7,9H2,1H3,(H,20,21)(H2,17,18,22) |
| InChIKey | MEEZYBICZXSATA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |