C21H31N3O4 — CID 122075292
(3aS,6aR)-2-[[2-[2-(diethylamino)ethoxy]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122075292) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is (3aS,6aR)-2-[[2-[2-(diethylamino)ethoxy]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[2-[2-(diethylamino)ethoxy]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122075292 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (3aS,6aR)-2-[[2-[2-(diethylamino)ethoxy]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C21H31N3O4/c1-3-23(4-2)12-13-28-18-10-6-5-9-17(18)22-20(27)24-14-16-8-7-11-21(16,15-24)19(25)26/h5-6,9-10,16H,3-4,7-8,11-15H2,1-2H3,(H,22,27)(H,25,26)/t16-,21+/m0/s1 |
| InChIKey | WQYPSYDFGPGOMX-HRAATJIYSA-N |
| XLogP | 3.13 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |