C20H25N3O4 — CID 122076491
(3aS,6aR)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122076491) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (3aS,6aR)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122076491 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (3aS,6aR)-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C1CCCN1Cc1ccc(NC(=O)N2C[C@@H]3CCC[C@@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C20H25N3O4/c24-17-4-2-10-22(17)11-14-5-7-16(8-6-14)21-19(27)23-12-15-3-1-9-20(15,13-23)18(25)26/h5-8,15H,1-4,9-13H2,(H,21,27)(H,25,26)/t15-,20+/m0/s1 |
| InChIKey | BUTPWPKIVFWQLG-MGPUTAFESA-N |
| XLogP | 2.53 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |