About 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid
3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid (PubChem CID 122076921) has the molecular formula C22H27N3O4
and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid |
| PubChem CID | 122076921 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid |
| SMILES | CC1CN(c2ccccc2NC(=O)Nc2cccc(CCC(=O)O)c2)CC(C)O1 |
| InChI | InChI=1S/C22H27N3O4/c1-15-13-25(14-16(2)29-15)20-9-4-3-8-19(20)24-22(28)23-18-7-5-6-17(12-18)10-11-21(26)27/h3-9,12,15-16H,10-11,13-14H2,1-2H3,(H,26,27)(H2,23,24,28) |
| InChIKey | BEHDIFVVHMIGJD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid?
The IUPAC name of 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid (CID 122076921) is 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid.
What is the SMILES notation for 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid?
The canonical SMILES for 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid is CC1CN(c2ccccc2NC(=O)Nc2cccc(CCC(=O)O)c2)CC(C)O1.
What is the InChIKey of 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid?
The InChIKey is BEHDIFVVHMIGJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O4/c1-15-13-25(14-16(2)29-15)20-9-4-3-8-19(20)24-22(28)23-18-7-5-6-17(12-18)10-11-21(26)27/h3-9,12,15-16H,10-11,13-14H2,1-2H3,(H,26,27)(H2,23,24,28).
What are the key properties of 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid?
3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid has a molecular weight of 397.48 g/mol, XLogP of 3.96, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[[2-(2,6-dimethylmorpholin-4-yl)phenyl]carbamoylamino]phenyl]propanoic acid is sourced from PubChem (CID 122076921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).