C16H18N4O4 — CID 122078035
4-[(2-methyl-4-pyrimidin-2-yloxyphenyl)carbamoylamino]butanoic acid (PubChem CID 122078035) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[(2-methyl-4-pyrimidin-2-yloxyphenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(2-methyl-4-pyrimidin-2-yloxyphenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122078035 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-[(2-methyl-4-pyrimidin-2-yloxyphenyl)carbamoylamino]butanoic acid |
| SMILES | Cc1cc(Oc2ncccn2)ccc1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C16H18N4O4/c1-11-10-12(24-16-18-8-3-9-19-16)5-6-13(11)20-15(23)17-7-2-4-14(21)22/h3,5-6,8-10H,2,4,7H2,1H3,(H,21,22)(H2,17,20,23) |
| InChIKey | WKZQOKIVSZCRJT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|