C16H22N6O4 — CID 122078811
4-[[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]carbamoylamino]-4-methylpentanoic acid (PubChem CID 122078811) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122078811 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-[[4-methoxy-3-(5-methyltetrazol-1-yl)phenyl]carbamoylamino]-4-methylpentanoic acid |
| SMILES | COc1ccc(NC(=O)NC(C)(C)CCC(=O)O)cc1-n1nnnc1C |
| InChI | InChI=1S/C16H22N6O4/c1-10-19-20-21-22(10)12-9-11(5-6-13(12)26-4)17-15(25)18-16(2,3)8-7-14(23)24/h5-6,9H,7-8H2,1-4H3,(H,23,24)(H2,17,18,25) |
| InChIKey | UFSGXBHSIMMBKJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |