C17H20F3N3O3 — CID 122079542
2-[cyclopropylmethyl-[3-[(2,4,5-trifluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122079542) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(2,4,5-trifluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(2,4,5-trifluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122079542 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(2,4,5-trifluorophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(NC(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C17H20F3N3O3/c18-12-5-14(20)15(6-13(12)19)22-17(26)21-10-3-11(4-10)23(8-16(24)25)7-9-1-2-9/h5-6,9-11H,1-4,7-8H2,(H,24,25)(H2,21,22,26) |
| InChIKey | CMERASBURRENSL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|