C16H22ClN3O4 — CID 122079613
4-[[2-chloro-5-[methyl(propan-2-yl)carbamoyl]phenyl]carbamoylamino]butanoic acid (PubChem CID 122079613) has the molecular formula C16H22ClN3O4 and a molecular weight of 355.82 g/mol. Its IUPAC name is 4-[[2-chloro-5-[methyl(propan-2-yl)carbamoyl]phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-chloro-5-[methyl(propan-2-yl)carbamoyl]phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122079613 |
| Molecular Formula | C16H22ClN3O4 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[[2-chloro-5-[methyl(propan-2-yl)carbamoyl]phenyl]carbamoylamino]butanoic acid |
| SMILES | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C16H22ClN3O4/c1-10(2)20(3)15(23)11-6-7-12(17)13(9-11)19-16(24)18-8-4-5-14(21)22/h6-7,9-10H,4-5,8H2,1-3H3,(H,21,22)(H2,18,19,24) |
| InChIKey | BXVJKHATBLYEDJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|