C17H31N3O — CID 122081454
[3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone (PubChem CID 122081454) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is [3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone.
| Compound Name | [3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 122081454 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | [3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[(2S)-pyrrolidin-2-yl]methanone |
| SMILES | CC1CCN(CC2CCCN(C(=O)[C@@H]3CCCN3)C2)CC1 |
| InChI | InChI=1S/C17H31N3O/c1-14-6-10-19(11-7-14)12-15-4-3-9-20(13-15)17(21)16-5-2-8-18-16/h14-16,18H,2-13H2,1H3/t15?,16-/m0/s1 |
| InChIKey | GRPQABQNIZRSFA-LYKKTTPLSA-N |
| XLogP | 1.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |