C14H30ClN3O — CID 122081502
(2S)-N-[3-(dipropylamino)propyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 122081502) has the molecular formula C14H30ClN3O and a molecular weight of 291.87 g/mol. Its IUPAC name is (2S)-N-[3-(dipropylamino)propyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[3-(dipropylamino)propyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122081502 |
| Molecular Formula | C14H30ClN3O |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (2S)-N-[3-(dipropylamino)propyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CCCN(CCC)CCCNC(=O)[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C14H29N3O.ClH/c1-3-10-17(11-4-2)12-6-9-16-14(18)13-7-5-8-15-13;/h13,15H,3-12H2,1-2H3,(H,16,18);1H/t13-;/m0./s1 |
| InChIKey | IOLRQGDPNQRHBQ-ZOWNYOTGSA-N |
| XLogP | 1.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|